C17H14N4O2 — CID 140978353
N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-benzimidazole-2-carboxamide (PubChem CID 140978353) has the molecular formula C17H14N4O2 and a molecular weight of 306.32 g/mol. Its IUPAC name is N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-benzimidazole-2-carboxamide.
| Compound Name | N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 140978353 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-benzimidazole-2-carboxamide |
| SMILES | O=C1CCc2cc(NC(=O)c3nc4ccccc4[nH]3)ccc2N1 |
| InChI | InChI=1S/C17H14N4O2/c22-15-8-5-10-9-11(6-7-12(10)19-15)18-17(23)16-20-13-3-1-2-4-14(13)21-16/h1-4,6-7,9H,5,8H2,(H,18,23)(H,19,22)(H,20,21) |
| InChIKey | UJGPGGITCUIHSG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |