C14H22N2O5 — CID 140981408
ethyl 2-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyridin-2-yl]acetate (PubChem CID 140981408) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl 2-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyridin-2-yl]acetate.
| Compound Name | ethyl 2-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyridin-2-yl]acetate |
|---|---|
| PubChem CID | 140981408 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | ethyl 2-[2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1H-pyridin-2-yl]acetate |
| SMILES | CCOC(=O)CC1(O)NC=CC=C1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O5/c1-5-20-11(17)9-14(19)10(7-6-8-15-14)16-12(18)21-13(2,3)4/h6-8,15,19H,5,9H2,1-4H3,(H,16,18) |
| InChIKey | ULSLEUUHVVQELN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |