C13H20InNO4 — CID 142682531
ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]indigol-1-yl]acetate (PubChem CID 142682531) has the molecular formula C13H20InNO4 and a molecular weight of 369.12 g/mol. Its IUPAC name is ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]indigol-1-yl]acetate.
| Compound Name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]indigol-1-yl]acetate |
|---|---|
| PubChem CID | 142682531 |
| Molecular Formula | C13H20InNO4 |
| Molecular Weight | 369.12 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]indigol-1-yl]acetate |
| SMILES | CCOC(=O)C[In]1C=CC=C1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H13NO2.C4H7O2.In/c1-5-6-7-10-8(11)12-9(2,3)4;1-3-6-4(2)5;/h1,5-6H,2-4H3,(H,10,11);2-3H2,1H3; |
| InChIKey | QLBDZQCTQOMJQP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.12 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |