About methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate
methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate (PubChem CID 140982227) has the molecular formula C15H13F2N3O4
and a molecular weight of 337.28 g/mol. Its IUPAC name is methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate |
| PubChem CID | 140982227 |
| Molecular Formula | C15H13F2N3O4 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate |
| SMILES | CCc1nc(=O)n(C(=O)OC)c(-c2ccc(F)c(F)c2)c1NC=O |
| InChI | InChI=1S/C15H13F2N3O4/c1-3-11-12(18-7-21)13(8-4-5-9(16)10(17)6-8)20(14(22)19-11)15(23)24-2/h4-7H,3H2,1-2H3,(H,18,21) |
| InChIKey | CSZISVFWOFQWRJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate?
The IUPAC name of methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate (CID 140982227) is methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate.
What is the SMILES notation for methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate?
The canonical SMILES for methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate is CCc1nc(=O)n(C(=O)OC)c(-c2ccc(F)c(F)c2)c1NC=O.
What is the InChIKey of methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate?
The InChIKey is CSZISVFWOFQWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2N3O4/c1-3-11-12(18-7-21)13(8-4-5-9(16)10(17)6-8)20(14(22)19-11)15(23)24-2/h4-7H,3H2,1-2H3,(H,18,21).
What are the key properties of methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate?
methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate has a molecular weight of 337.28 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(3,4-difluorophenyl)-4-ethyl-5-formamido-2-oxopyrimidine-1-carboxylate is sourced from PubChem (CID 140982227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).