About 3-benzyl-2H-oxazine
3-benzyl-2H-oxazine (PubChem CID 140983227) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-benzyl-2H-oxazine.
Molecular Properties
| Compound Name | 3-benzyl-2H-oxazine |
| PubChem CID | 140983227 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-benzyl-2H-oxazine |
| SMILES | C1=CONC(Cc2ccccc2)=C1 |
| InChI | InChI=1S/C11H11NO/c1-2-5-10(6-3-1)9-11-7-4-8-13-12-11/h1-8,12H,9H2 |
| InChIKey | OGGRIOGFWOHIIE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-2H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2H-oxazine?
The IUPAC name of 3-benzyl-2H-oxazine (CID 140983227) is 3-benzyl-2H-oxazine.
What is the SMILES notation for 3-benzyl-2H-oxazine?
The canonical SMILES for 3-benzyl-2H-oxazine is C1=CONC(Cc2ccccc2)=C1.
What is the InChIKey of 3-benzyl-2H-oxazine?
The InChIKey is OGGRIOGFWOHIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-2-5-10(6-3-1)9-11-7-4-8-13-12-11/h1-8,12H,9H2.
What are the key properties of 3-benzyl-2H-oxazine?
3-benzyl-2H-oxazine has a molecular weight of 173.21 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2H-oxazine is sourced from PubChem (CID 140983227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).