C16H22N6O2 — CID 140983432
2-pyrazol-1-yl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pentanoic acid (PubChem CID 140983432) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-pyrazol-1-yl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pentanoic acid.
| Compound Name | 2-pyrazol-1-yl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 140983432 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-pyrazol-1-yl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pentanoic acid |
| SMILES | O=C(O)C(CCCN1CCN(c2ncccn2)CC1)n1cccn1 |
| InChI | InChI=1S/C16H22N6O2/c23-15(24)14(22-9-3-7-19-22)4-1-8-20-10-12-21(13-11-20)16-17-5-2-6-18-16/h2-3,5-7,9,14H,1,4,8,10-13H2,(H,23,24) |
| InChIKey | VHFCKDUSUHBKGE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |