C10H11N3OS — CID 140984610
4-ethyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 140984610) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-ethyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-ethyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 140984610 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4-ethyl-2-methylsulfanyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCc1nc(SC)nc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C10H11N3OS/c1-3-7-6-4-5-8(14)12-9(6)13-10(11-7)15-2/h4-5H,3H2,1-2H3,(H,11,12,13,14) |
| InChIKey | LXSQOFAKVITGGE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |