C11H12NOS+ — CID 140985644
3-(2-phenoxyethyl)-1,3-thiazol-3-ium (PubChem CID 140985644) has the molecular formula C11H12NOS+ and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(2-phenoxyethyl)-1,3-thiazol-3-ium.
| Compound Name | 3-(2-phenoxyethyl)-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 140985644 |
| Molecular Formula | C11H12NOS+ |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3-(2-phenoxyethyl)-1,3-thiazol-3-ium |
| SMILES | c1ccc(OCC[n+]2ccsc2)cc1 |
| InChI | InChI=1S/C11H12NOS/c1-2-4-11(5-3-1)13-8-6-12-7-9-14-10-12/h1-5,7,9-10H,6,8H2/q+1 |
| InChIKey | REDNGADAVYQPRD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|