C16H22BrNOS — CID 140985663
1-(4-pentylphenyl)-2-(1,3-thiazol-3-ium-3-yl)ethanol bromide (PubChem CID 140985663) has the molecular formula C16H22BrNOS and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-(4-pentylphenyl)-2-(1,3-thiazol-3-ium-3-yl)ethanol bromide.
| Compound Name | 1-(4-pentylphenyl)-2-(1,3-thiazol-3-ium-3-yl)ethanol bromide |
|---|---|
| PubChem CID | 140985663 |
| Molecular Formula | C16H22BrNOS |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 1-(4-pentylphenyl)-2-(1,3-thiazol-3-ium-3-yl)ethanol bromide |
| SMILES | CCCCCc1ccc(C(O)C[n+]2ccsc2)cc1.[Br-] |
| InChI | InChI=1S/C16H22NOS.BrH/c1-2-3-4-5-14-6-8-15(9-7-14)16(18)12-17-10-11-19-13-17;/h6-11,13,16,18H,2-5,12H2,1H3;1H/q+1;/p-1 |
| InChIKey | NKTAMPDOOAOVFT-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|