C16H28N2O8 — CID 140985984
2-methylpentan-2-yl 2-[[[2-(2-methylpentan-2-yloxy)-2-oxoacetyl]amino]peroxyamino]-2-oxoacetate (PubChem CID 140985984) has the molecular formula C16H28N2O8 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-methylpentan-2-yl 2-[[[2-(2-methylpentan-2-yloxy)-2-oxoacetyl]amino]peroxyamino]-2-oxoacetate.
| Compound Name | 2-methylpentan-2-yl 2-[[[2-(2-methylpentan-2-yloxy)-2-oxoacetyl]amino]peroxyamino]-2-oxoacetate |
|---|---|
| PubChem CID | 140985984 |
| Molecular Formula | C16H28N2O8 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-methylpentan-2-yl 2-[[[2-(2-methylpentan-2-yloxy)-2-oxoacetyl]amino]peroxyamino]-2-oxoacetate |
| SMILES | CCCC(C)(C)OC(=O)C(=O)NOONC(=O)C(=O)OC(C)(C)CCC |
| InChI | InChI=1S/C16H28N2O8/c1-7-9-15(3,4)23-13(21)11(19)17-25-26-18-12(20)14(22)24-16(5,6)10-8-2/h7-10H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | OGAJFNCZEDMWNL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|