C20H20N2O4S2 — CID 140986681
7-methoxy-N-[(3S)-2-oxopyrrolidin-3-yl]-N-(thiophen-3-ylmethyl)naphthalene-2-sulfonamide (PubChem CID 140986681) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 7-methoxy-N-[(3S)-2-oxopyrrolidin-3-yl]-N-(thiophen-3-ylmethyl)naphthalene-2-sulfonamide.
| Compound Name | 7-methoxy-N-[(3S)-2-oxopyrrolidin-3-yl]-N-(thiophen-3-ylmethyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 140986681 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 7-methoxy-N-[(3S)-2-oxopyrrolidin-3-yl]-N-(thiophen-3-ylmethyl)naphthalene-2-sulfonamide |
| SMILES | COc1ccc2ccc(S(=O)(=O)N(Cc3ccsc3)[C@H]3CCNC3=O)cc2c1 |
| InChI | InChI=1S/C20H20N2O4S2/c1-26-17-4-2-15-3-5-18(11-16(15)10-17)28(24,25)22(12-14-7-9-27-13-14)19-6-8-21-20(19)23/h2-5,7,9-11,13,19H,6,8,12H2,1H3,(H,21,23)/t19-/m0/s1 |
| InChIKey | SPYMGPUHWNHRBH-IBGZPJMESA-N |
| XLogP | 2.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |