C10H11BrO2 — CID 140987147
5-bromo-6-methoxy-2,3,4,5-tetrahydroinden-1-one (PubChem CID 140987147) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is 5-bromo-6-methoxy-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 5-bromo-6-methoxy-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 140987147 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 5-bromo-6-methoxy-2,3,4,5-tetrahydroinden-1-one |
| SMILES | COC1=CC2=C(CCC2=O)CC1Br |
| InChI | InChI=1S/C10H11BrO2/c1-13-10-5-7-6(4-8(10)11)2-3-9(7)12/h5,8H,2-4H2,1H3 |
| InChIKey | LUJDWURBWCPKCE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|