C10H11BrO — CID 170736435
5-bromo-6-methyl-2,3,4,5-tetrahydroinden-1-one (PubChem CID 170736435) has the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. Its IUPAC name is 5-bromo-6-methyl-2,3,4,5-tetrahydroinden-1-one.
| Compound Name | 5-bromo-6-methyl-2,3,4,5-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 170736435 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 5-bromo-6-methyl-2,3,4,5-tetrahydroinden-1-one |
| SMILES | CC1=CC2=C(CCC2=O)CC1Br |
| InChI | InChI=1S/C10H11BrO/c1-6-4-8-7(5-9(6)11)2-3-10(8)12/h4,9H,2-3,5H2,1H3 |
| InChIKey | HIMZTNYQOBOMGW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|