C12H15BrO — CID 19036866
7-bromo-5,6,7,8,9,10-hexahydro-3H-benzo[8]annulen-4-one (PubChem CID 19036866) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 7-bromo-5,6,7,8,9,10-hexahydro-3H-benzo[8]annulen-4-one.
| Compound Name | 7-bromo-5,6,7,8,9,10-hexahydro-3H-benzo[8]annulen-4-one |
|---|---|
| PubChem CID | 19036866 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 7-bromo-5,6,7,8,9,10-hexahydro-3H-benzo[8]annulen-4-one |
| SMILES | O=C1CC=CC2=C1CCC(Br)CCC2 |
| InChI | InChI=1S/C12H15BrO/c13-10-5-1-3-9-4-2-6-12(14)11(9)8-7-10/h2,4,10H,1,3,5-8H2 |
| InChIKey | XXCMJKSLBHIZNO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|