C23H28FN5O2 — CID 14098744
1-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-(pyridin-2-ylmethyl)piperazine-2,6-dione (PubChem CID 14098744) has the molecular formula C23H28FN5O2 and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-(pyridin-2-ylmethyl)piperazine-2,6-dione.
| Compound Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-(pyridin-2-ylmethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 14098744 |
| Molecular Formula | C23H28FN5O2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-(pyridin-2-ylmethyl)piperazine-2,6-dione |
| SMILES | O=C1CN(Cc2ccccn2)CC(=O)N1CCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H28FN5O2/c24-19-5-7-21(8-6-19)28-14-12-26(13-15-28)10-3-11-29-22(30)17-27(18-23(29)31)16-20-4-1-2-9-25-20/h1-2,4-9H,3,10-18H2 |
| InChIKey | QBQNVWYNYUJWAR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 59.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|