C30H31FN4O2 — CID 15086307
1-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-4-(pyridin-2-ylmethyl)piperazine-2,6-dione (PubChem CID 15086307) has the molecular formula C30H31FN4O2 and a molecular weight of 498.60 g/mol. Its IUPAC name is 1-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-4-(pyridin-2-ylmethyl)piperazine-2,6-dione.
| Compound Name | 1-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-4-(pyridin-2-ylmethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 15086307 |
| Molecular Formula | C30H31FN4O2 |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 1-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-4-(pyridin-2-ylmethyl)piperazine-2,6-dione |
| SMILES | O=C1CN(Cc2ccccn2)CC(=O)N1CCN1CCC(=C(c2ccccc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H31FN4O2/c31-26-11-9-24(10-12-26)30(23-6-2-1-3-7-23)25-13-16-33(17-14-25)18-19-35-28(36)21-34(22-29(35)37)20-27-8-4-5-15-32-27/h1-12,15H,13-14,16-22H2 |
| InChIKey | SDHUMYWQPQNXGQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|