C31H30O4 — CID 140989107
2-[(4-methoxy-2-phenylmethoxyphenyl)methyl]-3,3-diphenylbutanoic acid (PubChem CID 140989107) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[(4-methoxy-2-phenylmethoxyphenyl)methyl]-3,3-diphenylbutanoic acid.
| Compound Name | 2-[(4-methoxy-2-phenylmethoxyphenyl)methyl]-3,3-diphenylbutanoic acid |
|---|---|
| PubChem CID | 140989107 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-[(4-methoxy-2-phenylmethoxyphenyl)methyl]-3,3-diphenylbutanoic acid |
| SMILES | COc1ccc(CC(C(=O)O)C(C)(c2ccccc2)c2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H30O4/c1-31(25-14-8-4-9-15-25,26-16-10-5-11-17-26)28(30(32)33)20-24-18-19-27(34-2)21-29(24)35-22-23-12-6-3-7-13-23/h3-19,21,28H,20,22H2,1-2H3,(H,32,33) |
| InChIKey | MNFWOCINVOOSMI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |