C21H33Cl2NO — CID 140989276
1-(4-chlorophenyl)-2-[4-(cyclohexylmethyl)piperidin-1-yl]propan-1-ol;hydrochloride (PubChem CID 140989276) has the molecular formula C21H33Cl2NO and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[4-(cyclohexylmethyl)piperidin-1-yl]propan-1-ol;hydrochloride.
| Compound Name | 1-(4-chlorophenyl)-2-[4-(cyclohexylmethyl)piperidin-1-yl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 140989276 |
| Molecular Formula | C21H33Cl2NO |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[4-(cyclohexylmethyl)piperidin-1-yl]propan-1-ol;hydrochloride |
| SMILES | CC(C(O)c1ccc(Cl)cc1)N1CCC(CC2CCCCC2)CC1.Cl |
| InChI | InChI=1S/C21H32ClNO.ClH/c1-16(21(24)19-7-9-20(22)10-8-19)23-13-11-18(12-14-23)15-17-5-3-2-4-6-17;/h7-10,16-18,21,24H,2-6,11-15H2,1H3;1H |
| InChIKey | NIMQNCHJMNTXLX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |