C27H37NO2 — CID 71008556
4-[2-[4-[(3-cyclohexylphenyl)methyl]piperidin-1-yl]-1-hydroxypropyl]phenol (PubChem CID 71008556) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 4-[2-[4-[(3-cyclohexylphenyl)methyl]piperidin-1-yl]-1-hydroxypropyl]phenol.
| Compound Name | 4-[2-[4-[(3-cyclohexylphenyl)methyl]piperidin-1-yl]-1-hydroxypropyl]phenol |
|---|---|
| PubChem CID | 71008556 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 4-[2-[4-[(3-cyclohexylphenyl)methyl]piperidin-1-yl]-1-hydroxypropyl]phenol |
| SMILES | CC(C(O)c1ccc(O)cc1)N1CCC(Cc2cccc(C3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C27H37NO2/c1-20(27(30)24-10-12-26(29)13-11-24)28-16-14-21(15-17-28)18-22-6-5-9-25(19-22)23-7-3-2-4-8-23/h5-6,9-13,19-21,23,27,29-30H,2-4,7-8,14-18H2,1H3 |
| InChIKey | CDSRUKXTHXQUEV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |