C29H45N3O — CID 45258577
(1R,2R)-1-[4-(8-aminooctylamino)phenyl]-2-(4-benzylpiperidin-1-yl)propan-1-ol (PubChem CID 45258577) has the molecular formula C29H45N3O and a molecular weight of 451.70 g/mol. Its IUPAC name is (1R,2R)-1-[4-(8-aminooctylamino)phenyl]-2-(4-benzylpiperidin-1-yl)propan-1-ol.
| Compound Name | (1R,2R)-1-[4-(8-aminooctylamino)phenyl]-2-(4-benzylpiperidin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 45258577 |
| Molecular Formula | C29H45N3O |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.36 |
| IUPAC Name | (1R,2R)-1-[4-(8-aminooctylamino)phenyl]-2-(4-benzylpiperidin-1-yl)propan-1-ol |
| SMILES | C[C@H]([C@H](O)c1ccc(NCCCCCCCCN)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H45N3O/c1-24(32-21-17-26(18-22-32)23-25-11-7-6-8-12-25)29(33)27-13-15-28(16-14-27)31-20-10-5-3-2-4-9-19-30/h6-8,11-16,24,26,29,31,33H,2-5,9-10,17-23,30H2,1H3/t24-,29+/m1/s1 |
| InChIKey | PHPLMCCZSNBMBQ-GIGWZHCTSA-N |
| XLogP | 5.77 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|