C34H36N2O — CID 45258806
(1R,2R)-1-[4-(benzhydrylideneamino)phenyl]-2-(4-benzylpiperidin-1-yl)propan-1-ol (PubChem CID 45258806) has the molecular formula C34H36N2O and a molecular weight of 488.68 g/mol. Its IUPAC name is (1R,2R)-1-[4-(benzhydrylideneamino)phenyl]-2-(4-benzylpiperidin-1-yl)propan-1-ol.
| Compound Name | (1R,2R)-1-[4-(benzhydrylideneamino)phenyl]-2-(4-benzylpiperidin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 45258806 |
| Molecular Formula | C34H36N2O |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (1R,2R)-1-[4-(benzhydrylideneamino)phenyl]-2-(4-benzylpiperidin-1-yl)propan-1-ol |
| SMILES | C[C@H]([C@H](O)c1ccc(N=C(c2ccccc2)c2ccccc2)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C34H36N2O/c1-26(36-23-21-28(22-24-36)25-27-11-5-2-6-12-27)34(37)31-17-19-32(20-18-31)35-33(29-13-7-3-8-14-29)30-15-9-4-10-16-30/h2-20,26,28,34,37H,21-25H2,1H3/t26-,34+/m1/s1 |
| InChIKey | QLEQXRRWIVZMEE-SFRLIIPVSA-N |
| XLogP | 7.23 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|