C17H18N2O6 — CID 140990814
2-[acetyl-[3-(4-cyanophenyl)propanoyl]amino]-3-ethoxy-3-oxopropanoic acid (PubChem CID 140990814) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[acetyl-[3-(4-cyanophenyl)propanoyl]amino]-3-ethoxy-3-oxopropanoic acid.
| Compound Name | 2-[acetyl-[3-(4-cyanophenyl)propanoyl]amino]-3-ethoxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 140990814 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-[acetyl-[3-(4-cyanophenyl)propanoyl]amino]-3-ethoxy-3-oxopropanoic acid |
| SMILES | CCOC(=O)C(C(=O)O)N(C(C)=O)C(=O)CCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H18N2O6/c1-3-25-17(24)15(16(22)23)19(11(2)20)14(21)9-8-12-4-6-13(10-18)7-5-12/h4-7,15H,3,8-9H2,1-2H3,(H,22,23) |
| InChIKey | BSESXNRZXWEWHG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|