C16H26NO2PS — CID 140993900
2-diethylphosphoryl-1-[2-(1-methylcyclohexyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 140993900) has the molecular formula C16H26NO2PS and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-diethylphosphoryl-1-[2-(1-methylcyclohexyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 2-diethylphosphoryl-1-[2-(1-methylcyclohexyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 140993900 |
| Molecular Formula | C16H26NO2PS |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-diethylphosphoryl-1-[2-(1-methylcyclohexyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CCP(=O)(CC)CC(=O)c1csc(C2(C)CCCCC2)n1 |
| InChI | InChI=1S/C16H26NO2PS/c1-4-20(19,5-2)11-14(18)13-12-21-15(17-13)16(3)9-7-6-8-10-16/h12H,4-11H2,1-3H3 |
| InChIKey | HPYLCLAYRSGXKY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|