C11H15NO3 — CID 115026295
5-(1-methylcyclohexyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 115026295) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 5-(1-methylcyclohexyl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(1-methylcyclohexyl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 115026295 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 5-(1-methylcyclohexyl)-1,2-oxazole-3-carboxylic acid |
| SMILES | CC1(c2cc(C(=O)O)no2)CCCCC1 |
| InChI | InChI=1S/C11H15NO3/c1-11(5-3-2-4-6-11)9-7-8(10(13)14)12-15-9/h7H,2-6H2,1H3,(H,13,14) |
| InChIKey | AWFMVJFSNUICMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |