About 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide
7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide (PubChem CID 167885380) has the molecular formula C18H28N4O2
and a molecular weight of 332.45 g/mol. Its IUPAC name is 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide.
Molecular Properties
| Compound Name | 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide |
| PubChem CID | 167885380 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide |
| SMILES | CN1CCC2(CC1)CCN2C(=O)Nc1cc(C2(C)CCCC2)on1 |
| InChI | InChI=1S/C18H28N4O2/c1-17(5-3-4-6-17)14-13-15(20-24-14)19-16(23)22-12-9-18(22)7-10-21(2)11-8-18/h13H,3-12H2,1-2H3,(H,19,20,23) |
| InChIKey | QSKOVVDTXQJRMO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide?
The IUPAC name of 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide (CID 167885380) is 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide.
What is the SMILES notation for 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide?
The canonical SMILES for 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide is CN1CCC2(CC1)CCN2C(=O)Nc1cc(C2(C)CCCC2)on1.
What is the InChIKey of 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide?
The InChIKey is QSKOVVDTXQJRMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N4O2/c1-17(5-3-4-6-17)14-13-15(20-24-14)19-16(23)22-12-9-18(22)7-10-21(2)11-8-18/h13H,3-12H2,1-2H3,(H,19,20,23).
What are the key properties of 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide?
7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide has a molecular weight of 332.45 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-N-[5-(1-methylcyclopentyl)-1,2-oxazol-3-yl]-1,7-diazaspiro[3.5]nonane-1-carboxamide is sourced from PubChem (CID 167885380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).