C10H14N2O4 — CID 71150223
[5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid (PubChem CID 71150223) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid.
| Compound Name | [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid |
|---|---|
| PubChem CID | 71150223 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid |
| SMILES | CC1(c2cc(NC(=O)O)no2)CCOCC1 |
| InChI | InChI=1S/C10H14N2O4/c1-10(2-4-15-5-3-10)7-6-8(12-16-7)11-9(13)14/h6H,2-5H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | CMMNPGVUQXDFCO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |