[5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid

C10H14N2O4 — CID 71150223

IUPAC[5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid
SMILESCC1(c2cc(NC(=O)O)no2)CCOCC1
InChIInChI=1S/C10H14N2O4/c1-10(2-4-15-5-3-10)7-6-8(12-16-7)11-9(13)14/h6H,2-5H2,1H3,(H,11,12)(H,13,14)
InChIKeyCMMNPGVUQXDFCO-UHFFFAOYSA-N
MW226.23 g/mol
LogP1.83
Rot. Bonds2

About [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid

[5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid (PubChem CID 71150223) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid.

Molecular Properties

Compound Name[5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid
PubChem CID71150223
Molecular FormulaC10H14N2O4
Molecular Weight226.23 g/mol
Exact Mass226.10
IUPAC Name[5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid
SMILESCC1(c2cc(NC(=O)O)no2)CCOCC1
InChIInChI=1S/C10H14N2O4/c1-10(2-4-15-5-3-10)7-6-8(12-16-7)11-9(13)14/h6H,2-5H2,1H3,(H,11,12)(H,13,14)
InChIKeyCMMNPGVUQXDFCO-UHFFFAOYSA-N
XLogP1.83
TPSA84.59 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 51.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid?
The IUPAC name of [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid (CID 71150223) is [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid.
What is the SMILES notation for [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid?
The canonical SMILES for [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid is CC1(c2cc(NC(=O)O)no2)CCOCC1.
What is the InChIKey of [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid?
The InChIKey is CMMNPGVUQXDFCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-10(2-4-15-5-3-10)7-6-8(12-16-7)11-9(13)14/h6H,2-5H2,1H3,(H,11,12)(H,13,14).
What are the key properties of [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid?
[5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid has a molecular weight of 226.23 g/mol, XLogP of 1.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-methyloxan-4-yl)-1,2-oxazol-3-yl]carbamic acid is sourced from PubChem (CID 71150223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).