C12H16O3 — CID 140994731
2,2-dimethoxy-3,4,4a,5-tetrahydronaphthalen-1-one (PubChem CID 140994731) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2,2-dimethoxy-3,4,4a,5-tetrahydronaphthalen-1-one.
| Compound Name | 2,2-dimethoxy-3,4,4a,5-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 140994731 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2,2-dimethoxy-3,4,4a,5-tetrahydronaphthalen-1-one |
| SMILES | COC1(OC)CCC2CC=CC=C2C1=O |
| InChI | InChI=1S/C12H16O3/c1-14-12(15-2)8-7-9-5-3-4-6-10(9)11(12)13/h3-4,6,9H,5,7-8H2,1-2H3 |
| InChIKey | XIHKVYQJTWEDGR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|