C12H18O3 — CID 14386769
3,3-dimethoxy-4,4a,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 14386769) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 3,3-dimethoxy-4,4a,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | 3,3-dimethoxy-4,4a,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 14386769 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 3,3-dimethoxy-4,4a,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | COC1(OC)CC2CCCCC2=CC1=O |
| InChI | InChI=1S/C12H18O3/c1-14-12(15-2)8-10-6-4-3-5-9(10)7-11(12)13/h7,10H,3-6,8H2,1-2H3 |
| InChIKey | SWADCJYVDZKSCB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|