C12H20O3 — CID 57102796
3-but-2-en-2-yl-4,4-dimethoxycyclohexan-1-one (PubChem CID 57102796) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-but-2-en-2-yl-4,4-dimethoxycyclohexan-1-one.
| Compound Name | 3-but-2-en-2-yl-4,4-dimethoxycyclohexan-1-one |
|---|---|
| PubChem CID | 57102796 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3-but-2-en-2-yl-4,4-dimethoxycyclohexan-1-one |
| SMILES | CC=C(C)C1CC(=O)CCC1(OC)OC |
| InChI | InChI=1S/C12H20O3/c1-5-9(2)11-8-10(13)6-7-12(11,14-3)15-4/h5,11H,6-8H2,1-4H3 |
| InChIKey | FQPGXMHJRPTDOD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|