C13H17NO4S2 — CID 140997187
S-[(3S)-1-(4-methoxyphenyl)sulfonylpyrrolidin-3-yl] ethanethioate (PubChem CID 140997187) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is S-[(3S)-1-(4-methoxyphenyl)sulfonylpyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[(3S)-1-(4-methoxyphenyl)sulfonylpyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 140997187 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | S-[(3S)-1-(4-methoxyphenyl)sulfonylpyrrolidin-3-yl] ethanethioate |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@H](SC(C)=O)C2)cc1 |
| InChI | InChI=1S/C13H17NO4S2/c1-10(15)19-12-7-8-14(9-12)20(16,17)13-5-3-11(18-2)4-6-13/h3-6,12H,7-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | IQRVUEZQRTUDDV-LBPRGKRZSA-N |
| XLogP | 1.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|