C36H20N6OS4 — CID 140997304
4-[3-(1H-benzotriazol-4-yl)-2-naphthalen-1-ylsulfanyl-6-(1H-pyrrol-2-yl)-5-thieno[3,2-b]thiophen-5-yl-1-benzofuran-4-yl]thiadiazole (PubChem CID 140997304) has the molecular formula C36H20N6OS4 and a molecular weight of 680.87 g/mol. Its IUPAC name is 4-[3-(1H-benzotriazol-4-yl)-2-naphthalen-1-ylsulfanyl-6-(1H-pyrrol-2-yl)-5-thieno[3,2-b]thiophen-5-yl-1-benzofuran-4-yl]thiadiazole.
| Compound Name | 4-[3-(1H-benzotriazol-4-yl)-2-naphthalen-1-ylsulfanyl-6-(1H-pyrrol-2-yl)-5-thieno[3,2-b]thiophen-5-yl-1-benzofuran-4-yl]thiadiazole |
|---|---|
| PubChem CID | 140997304 |
| Molecular Formula | C36H20N6OS4 |
| Molecular Weight | 680.87 g/mol |
| Exact Mass | 680.06 |
| IUPAC Name | 4-[3-(1H-benzotriazol-4-yl)-2-naphthalen-1-ylsulfanyl-6-(1H-pyrrol-2-yl)-5-thieno[3,2-b]thiophen-5-yl-1-benzofuran-4-yl]thiadiazole |
| SMILES | c1c[nH]c(-c2cc3oc(Sc4cccc5ccccc45)c(-c4cccc5[nH]nnc45)c3c(-c3csnn3)c2-c2cc3sccc3s2)c1 |
| InChI | InChI=1S/C36H20N6OS4/c1-2-8-20-19(6-1)7-3-12-27(20)47-36-32(21-9-4-10-24-35(21)40-41-38-24)34-26(43-36)16-22(23-11-5-14-37-23)31(33(34)25-18-45-42-39-25)30-17-29-28(46-30)13-15-44-29/h1-18,37H,(H,38,40,41) |
| InChIKey | AUFUZMJNXXSLCN-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.87 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |