C33H20N6OS2 — CID 141107879
4-[3-(furan-2-yl)-5-(1H-indol-2-yl)-6-(1H-pyrazol-3-yl)-2-thiophen-2-yl-1-benzothiophen-4-yl]-1H-benzotriazole (PubChem CID 141107879) has the molecular formula C33H20N6OS2 and a molecular weight of 580.70 g/mol. Its IUPAC name is 4-[3-(furan-2-yl)-5-(1H-indol-2-yl)-6-(1H-pyrazol-3-yl)-2-thiophen-2-yl-1-benzothiophen-4-yl]-1H-benzotriazole.
| Compound Name | 4-[3-(furan-2-yl)-5-(1H-indol-2-yl)-6-(1H-pyrazol-3-yl)-2-thiophen-2-yl-1-benzothiophen-4-yl]-1H-benzotriazole |
|---|---|
| PubChem CID | 141107879 |
| Molecular Formula | C33H20N6OS2 |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | 4-[3-(furan-2-yl)-5-(1H-indol-2-yl)-6-(1H-pyrazol-3-yl)-2-thiophen-2-yl-1-benzothiophen-4-yl]-1H-benzotriazole |
| SMILES | c1coc(-c2c(-c3cccs3)sc3cc(-c4cc[nH]n4)c(-c4cc5ccccc5[nH]4)c(-c4cccc5[nH]nnc45)c23)c1 |
| InChI | InChI=1S/C33H20N6OS2/c1-2-8-21-18(6-1)16-24(35-21)28-20(22-12-13-34-36-22)17-27-31(29(28)19-7-3-9-23-32(19)38-39-37-23)30(25-10-4-14-40-25)33(42-27)26-11-5-15-41-26/h1-17,35H,(H,34,36)(H,37,38,39) |
| InChIKey | UHAICQDQCUGUQU-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |