C32H21N3OS — CID 140997535
3-[2-(1-benzofuran-3-yl)-4-(1H-indol-3-yl)-1-benzothiophen-3-yl]-1-methylindazole (PubChem CID 140997535) has the molecular formula C32H21N3OS and a molecular weight of 495.61 g/mol. Its IUPAC name is 3-[2-(1-benzofuran-3-yl)-4-(1H-indol-3-yl)-1-benzothiophen-3-yl]-1-methylindazole.
| Compound Name | 3-[2-(1-benzofuran-3-yl)-4-(1H-indol-3-yl)-1-benzothiophen-3-yl]-1-methylindazole |
|---|---|
| PubChem CID | 140997535 |
| Molecular Formula | C32H21N3OS |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 3-[2-(1-benzofuran-3-yl)-4-(1H-indol-3-yl)-1-benzothiophen-3-yl]-1-methylindazole |
| SMILES | Cn1nc(-c2c(-c3coc4ccccc34)sc3cccc(-c4c[nH]c5ccccc45)c23)c2ccccc21 |
| InChI | InChI=1S/C32H21N3OS/c1-35-26-14-6-3-11-22(26)31(34-35)30-29-21(23-17-33-25-13-5-2-9-19(23)25)12-8-16-28(29)37-32(30)24-18-36-27-15-7-4-10-20(24)27/h2-18,33H,1H3 |
| InChIKey | RSFLAGZDULQLRO-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |