C26H18N2OS — CID 90755845
2-[3-(furan-2-yl)-2-(1H-pyrrol-2-yl)-4-thiophen-2-ylphenyl]-1H-indole (PubChem CID 90755845) has the molecular formula C26H18N2OS and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-2-(1H-pyrrol-2-yl)-4-thiophen-2-ylphenyl]-1H-indole.
| Compound Name | 2-[3-(furan-2-yl)-2-(1H-pyrrol-2-yl)-4-thiophen-2-ylphenyl]-1H-indole |
|---|---|
| PubChem CID | 90755845 |
| Molecular Formula | C26H18N2OS |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-[3-(furan-2-yl)-2-(1H-pyrrol-2-yl)-4-thiophen-2-ylphenyl]-1H-indole |
| SMILES | c1c[nH]c(-c2c(-c3cc4ccccc4[nH]3)ccc(-c3cccs3)c2-c2ccco2)c1 |
| InChI | InChI=1S/C26H18N2OS/c1-2-7-20-17(6-1)16-22(28-20)18-11-12-19(24-10-5-15-30-24)26(23-9-4-14-29-23)25(18)21-8-3-13-27-21/h1-16,27-28H |
| InChIKey | UDLLHAXCTBUDIR-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 44.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |