C23H26N2O2S — CID 18940856
4-[5-[(5-methoxy-1H-indol-3-yl)methyl]-3,6-dihydro-2H-pyridin-1-yl]-1-thiophen-2-ylbutan-1-one (PubChem CID 18940856) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is 4-[5-[(5-methoxy-1H-indol-3-yl)methyl]-3,6-dihydro-2H-pyridin-1-yl]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[5-[(5-methoxy-1H-indol-3-yl)methyl]-3,6-dihydro-2H-pyridin-1-yl]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 18940856 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-[5-[(5-methoxy-1H-indol-3-yl)methyl]-3,6-dihydro-2H-pyridin-1-yl]-1-thiophen-2-ylbutan-1-one |
| SMILES | COc1ccc2[nH]cc(CC3=CCCN(CCCC(=O)c4cccs4)C3)c2c1 |
| InChI | InChI=1S/C23H26N2O2S/c1-27-19-8-9-21-20(14-19)18(15-24-21)13-17-5-2-10-25(16-17)11-3-6-22(26)23-7-4-12-28-23/h4-5,7-9,12,14-15,24H,2-3,6,10-11,13,16H2,1H3 |
| InChIKey | FDYMYVCWNMKDLR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|