C24H15NOS — CID 130307454
6-[6-(1-benzofuran-2-yl)-1-benzothiophen-2-yl]-1H-indole (PubChem CID 130307454) has the molecular formula C24H15NOS and a molecular weight of 365.46 g/mol. Its IUPAC name is 6-[6-(1-benzofuran-2-yl)-1-benzothiophen-2-yl]-1H-indole.
| Compound Name | 6-[6-(1-benzofuran-2-yl)-1-benzothiophen-2-yl]-1H-indole |
|---|---|
| PubChem CID | 130307454 |
| Molecular Formula | C24H15NOS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 6-[6-(1-benzofuran-2-yl)-1-benzothiophen-2-yl]-1H-indole |
| SMILES | c1ccc2oc(-c3ccc4cc(-c5ccc6cc[nH]c6c5)sc4c3)cc2c1 |
| InChI | InChI=1S/C24H15NOS/c1-2-4-21-16(3-1)12-22(26-21)17-6-8-19-14-24(27-23(19)13-17)18-7-5-15-9-10-25-20(15)11-18/h1-14,25H |
| InChIKey | BAMKMUVMDKTNKE-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |