C11H20F3NS — CID 140997839
(2S)-2-[(5,5,5-trifluoro-4-methylpentyl)sulfanylmethyl]pyrrolidine (PubChem CID 140997839) has the molecular formula C11H20F3NS and a molecular weight of 255.35 g/mol. Its IUPAC name is (2S)-2-[(5,5,5-trifluoro-4-methylpentyl)sulfanylmethyl]pyrrolidine.
| Compound Name | (2S)-2-[(5,5,5-trifluoro-4-methylpentyl)sulfanylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 140997839 |
| Molecular Formula | C11H20F3NS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (2S)-2-[(5,5,5-trifluoro-4-methylpentyl)sulfanylmethyl]pyrrolidine |
| SMILES | CC(CCCSC[C@@H]1CCCN1)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NS/c1-9(11(12,13)14)4-3-7-16-8-10-5-2-6-15-10/h9-10,15H,2-8H2,1H3/t9?,10-/m0/s1 |
| InChIKey | BTDGKWBDRHQCEM-AXDSSHIGSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|