About 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane
1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane (PubChem CID 140997941) has the molecular formula C17H34O3
and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane.
Molecular Properties
| Compound Name | 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane |
| PubChem CID | 140997941 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane |
| SMILES | CCCCCCC1CCCC(OC)C1(COCC)OC |
| InChI | InChI=1S/C17H34O3/c1-5-7-8-9-11-15-12-10-13-16(18-3)17(15,19-4)14-20-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | UIVNSJYWWITCAA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane?
The IUPAC name of 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane (CID 140997941) is 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane.
What is the SMILES notation for 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane?
The canonical SMILES for 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane is CCCCCCC1CCCC(OC)C1(COCC)OC.
What is the InChIKey of 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane?
The InChIKey is UIVNSJYWWITCAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O3/c1-5-7-8-9-11-15-12-10-13-16(18-3)17(15,19-4)14-20-6-2/h15-16H,5-14H2,1-4H3.
What are the key properties of 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane?
1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane has a molecular weight of 286.46 g/mol, XLogP of 4.19, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethoxymethyl)-2-hexyl-1,6-dimethoxycyclohexane is sourced from PubChem (CID 140997941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).