About (4-methoxyphenyl) hydroxymethanesulfonate
(4-methoxyphenyl) hydroxymethanesulfonate (PubChem CID 140999217) has the molecular formula C8H10O5S
and a molecular weight of 218.23 g/mol. Its IUPAC name is (4-methoxyphenyl) hydroxymethanesulfonate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) hydroxymethanesulfonate |
| PubChem CID | 140999217 |
| Molecular Formula | C8H10O5S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | (4-methoxyphenyl) hydroxymethanesulfonate |
| SMILES | COc1ccc(OS(=O)(=O)CO)cc1 |
| InChI | InChI=1S/C8H10O5S/c1-12-7-2-4-8(5-3-7)13-14(10,11)6-9/h2-5,9H,6H2,1H3 |
| InChIKey | OOGBJRWTVPIZRB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) hydroxymethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) hydroxymethanesulfonate?
The IUPAC name of (4-methoxyphenyl) hydroxymethanesulfonate (CID 140999217) is (4-methoxyphenyl) hydroxymethanesulfonate.
What is the SMILES notation for (4-methoxyphenyl) hydroxymethanesulfonate?
The canonical SMILES for (4-methoxyphenyl) hydroxymethanesulfonate is COc1ccc(OS(=O)(=O)CO)cc1.
What is the InChIKey of (4-methoxyphenyl) hydroxymethanesulfonate?
The InChIKey is OOGBJRWTVPIZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5S/c1-12-7-2-4-8(5-3-7)13-14(10,11)6-9/h2-5,9H,6H2,1H3.
What are the key properties of (4-methoxyphenyl) hydroxymethanesulfonate?
(4-methoxyphenyl) hydroxymethanesulfonate has a molecular weight of 218.23 g/mol, XLogP of 0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) hydroxymethanesulfonate is sourced from PubChem (CID 140999217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).