C21H24ClNO2 — CID 140999569
N-[1-chloro-2-[4-(4-hydroxycyclohexyl)phenyl]ethyl]benzamide (PubChem CID 140999569) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is N-[1-chloro-2-[4-(4-hydroxycyclohexyl)phenyl]ethyl]benzamide.
| Compound Name | N-[1-chloro-2-[4-(4-hydroxycyclohexyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 140999569 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[1-chloro-2-[4-(4-hydroxycyclohexyl)phenyl]ethyl]benzamide |
| SMILES | O=C(NC(Cl)Cc1ccc(C2CCC(O)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H24ClNO2/c22-20(23-21(25)18-4-2-1-3-5-18)14-15-6-8-16(9-7-15)17-10-12-19(24)13-11-17/h1-9,17,19-20,24H,10-14H2,(H,23,25) |
| InChIKey | PPPZMBZIITZFTI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|