C17H22ClNO3S — CID 141000423
N-[3-(3-chlorophenyl)propyl]-N-[3-(furan-2-yl)propyl]methanesulfonamide (PubChem CID 141000423) has the molecular formula C17H22ClNO3S and a molecular weight of 355.89 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)propyl]-N-[3-(furan-2-yl)propyl]methanesulfonamide.
| Compound Name | N-[3-(3-chlorophenyl)propyl]-N-[3-(furan-2-yl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 141000423 |
| Molecular Formula | C17H22ClNO3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[3-(3-chlorophenyl)propyl]-N-[3-(furan-2-yl)propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(CCCc1cccc(Cl)c1)CCCc1ccco1 |
| InChI | InChI=1S/C17H22ClNO3S/c1-23(20,21)19(12-4-9-17-10-5-13-22-17)11-3-7-15-6-2-8-16(18)14-15/h2,5-6,8,10,13-14H,3-4,7,9,11-12H2,1H3 |
| InChIKey | JKTNJSSJWZHNQN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |