C22H28ClNO4S — CID 54185984
methyl 2-[3-[3-[3-(3-chlorophenyl)propyl-methylsulfonylamino]propyl]phenyl]acetate (PubChem CID 54185984) has the molecular formula C22H28ClNO4S and a molecular weight of 437.99 g/mol. Its IUPAC name is methyl 2-[3-[3-[3-(3-chlorophenyl)propyl-methylsulfonylamino]propyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[3-[3-(3-chlorophenyl)propyl-methylsulfonylamino]propyl]phenyl]acetate |
|---|---|
| PubChem CID | 54185984 |
| Molecular Formula | C22H28ClNO4S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | methyl 2-[3-[3-[3-(3-chlorophenyl)propyl-methylsulfonylamino]propyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(CCCN(CCCc2cccc(Cl)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H28ClNO4S/c1-28-22(25)17-20-9-3-7-18(15-20)10-5-13-24(29(2,26)27)14-6-11-19-8-4-12-21(23)16-19/h3-4,7-9,12,15-16H,5-6,10-11,13-14,17H2,1-2H3 |
| InChIKey | PFDIWEAJCFAUNL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |