C10H12O3 — CID 141001145
2-cyclopropyl-5-(hydroxymethylidene)cyclohexane-1,3-dione (PubChem CID 141001145) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-cyclopropyl-5-(hydroxymethylidene)cyclohexane-1,3-dione.
| Compound Name | 2-cyclopropyl-5-(hydroxymethylidene)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 141001145 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-cyclopropyl-5-(hydroxymethylidene)cyclohexane-1,3-dione |
| SMILES | O=C1CC(=CO)CC(=O)C1C1CC1 |
| InChI | InChI=1S/C10H12O3/c11-5-6-3-8(12)10(7-1-2-7)9(13)4-6/h5,7,10-11H,1-4H2/b6-5- |
| InChIKey | DMONFDMMWQYHLS-WAYWQWQTSA-N |
| XLogP | 1.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|