C11H16O2 — CID 82371844
(3Z)-3-(hydroxymethylidene)-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-one (PubChem CID 82371844) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3Z)-3-(hydroxymethylidene)-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-one.
| Compound Name | (3Z)-3-(hydroxymethylidene)-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-one |
|---|---|
| PubChem CID | 82371844 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (3Z)-3-(hydroxymethylidene)-1,4,4a,5,6,7,8,8a-octahydronaphthalen-2-one |
| SMILES | O=C1CC2CCCCC2C/C1=C/O |
| InChI | InChI=1S/C11H16O2/c12-7-10-5-8-3-1-2-4-9(8)6-11(10)13/h7-9,12H,1-6H2/b10-7- |
| InChIKey | NBROQSGAXMRSDT-YFHOEESVSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|