C13H15N5O3 — CID 141002179
ethyl 3-[1H-imidazole-5-carbonyl(pyrimidin-4-yl)amino]propanoate (PubChem CID 141002179) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is ethyl 3-[1H-imidazole-5-carbonyl(pyrimidin-4-yl)amino]propanoate.
| Compound Name | ethyl 3-[1H-imidazole-5-carbonyl(pyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 141002179 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | ethyl 3-[1H-imidazole-5-carbonyl(pyrimidin-4-yl)amino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)c1cnc[nH]1)c1ccncn1 |
| InChI | InChI=1S/C13H15N5O3/c1-2-21-12(19)4-6-18(11-3-5-14-8-17-11)13(20)10-7-15-9-16-10/h3,5,7-9H,2,4,6H2,1H3,(H,15,16) |
| InChIKey | HWJVTAQNXBFBBO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |