C13H17ClN4O4S — CID 141002666
N-(4-chlorobenzoyl)-N-methyl-4-sulfamoylpiperazine-1-carboxamide (PubChem CID 141002666) has the molecular formula C13H17ClN4O4S and a molecular weight of 360.82 g/mol. Its IUPAC name is N-(4-chlorobenzoyl)-N-methyl-4-sulfamoylpiperazine-1-carboxamide.
| Compound Name | N-(4-chlorobenzoyl)-N-methyl-4-sulfamoylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 141002666 |
| Molecular Formula | C13H17ClN4O4S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | N-(4-chlorobenzoyl)-N-methyl-4-sulfamoylpiperazine-1-carboxamide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1)C(=O)N1CCN(S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C13H17ClN4O4S/c1-16(12(19)10-2-4-11(14)5-3-10)13(20)17-6-8-18(9-7-17)23(15,21)22/h2-5H,6-9H2,1H3,(H2,15,21,22) |
| InChIKey | IGWLAXSMXJQNNB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |