C14H20N4O3 — CID 141003239
2-(2-amino-2-oxoethyl)-N-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 141003239) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)-N-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 2-(2-amino-2-oxoethyl)-N-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 141003239 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)-N-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCNCC2CC(N)=O)cc1 |
| InChI | InChI=1S/C14H20N4O3/c1-21-12-4-2-10(3-5-12)17-14(20)18-7-6-16-9-11(18)8-13(15)19/h2-5,11,16H,6-9H2,1H3,(H2,15,19)(H,17,20) |
| InChIKey | ZKNLRXWTWXIKDY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |