C22H30O2 — CID 141003439
ethyl (7R,10S,13S)-10,13-dimethyl-2,3,6,7,11,12,16,17-octahydro-1H-cyclopenta[a]phenanthrene-7-carboxylate (PubChem CID 141003439) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is ethyl (7R,10S,13S)-10,13-dimethyl-2,3,6,7,11,12,16,17-octahydro-1H-cyclopenta[a]phenanthrene-7-carboxylate.
| Compound Name | ethyl (7R,10S,13S)-10,13-dimethyl-2,3,6,7,11,12,16,17-octahydro-1H-cyclopenta[a]phenanthrene-7-carboxylate |
|---|---|
| PubChem CID | 141003439 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | ethyl (7R,10S,13S)-10,13-dimethyl-2,3,6,7,11,12,16,17-octahydro-1H-cyclopenta[a]phenanthrene-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2=CCCC[C@]2(C)C2=C1C1=CCC[C@@]1(C)CC2 |
| InChI | InChI=1S/C22H30O2/c1-4-24-20(23)16-14-15-8-5-6-12-22(15,3)18-10-13-21(2)11-7-9-17(21)19(16)18/h8-9,16H,4-7,10-14H2,1-3H3/t16-,21+,22+/m1/s1 |
| InChIKey | DSJLSXHVBCDGQA-XGRCMKMKSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|