C29H18N2OS — CID 141005014
2-[3-(1-benzofuran-2-yl)-2-(1-benzothiophen-2-yl)phenyl]-1H-benzimidazole (PubChem CID 141005014) has the molecular formula C29H18N2OS and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-[3-(1-benzofuran-2-yl)-2-(1-benzothiophen-2-yl)phenyl]-1H-benzimidazole.
| Compound Name | 2-[3-(1-benzofuran-2-yl)-2-(1-benzothiophen-2-yl)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 141005014 |
| Molecular Formula | C29H18N2OS |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-[3-(1-benzofuran-2-yl)-2-(1-benzothiophen-2-yl)phenyl]-1H-benzimidazole |
| SMILES | c1cc(-c2nc3ccccc3[nH]2)c(-c2cc3ccccc3s2)c(-c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C29H18N2OS/c1-5-14-24-18(8-1)16-25(32-24)20-10-7-11-21(29-30-22-12-3-4-13-23(22)31-29)28(20)27-17-19-9-2-6-15-26(19)33-27/h1-17H,(H,30,31) |
| InChIKey | RXPHKGDMUOWJRI-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |