C18H29NO2 — CID 141005343
1-[2-(2-methoxyphenoxy)ethyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 141005343) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenoxy)ethyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-[2-(2-methoxyphenoxy)ethyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 141005343 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-[2-(2-methoxyphenoxy)ethyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | COc1ccccc1OCCN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C18H29NO2/c1-17(2)11-8-12-18(3,4)19(17)13-14-21-16-10-7-6-9-15(16)20-5/h6-7,9-10H,8,11-14H2,1-5H3 |
| InChIKey | IJETYKFNKJXWGY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |